C21H27F2NO4S — CID 11293266
(E)-7-[(4S)-4-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]hept-5-enoic acid (PubChem CID 11293266) has the molecular formula C21H27F2NO4S and a molecular weight of 427.51 g/mol. Its IUPAC name is (E)-7-[(4S)-4-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[(4S)-4-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11293266 |
| Molecular Formula | C21H27F2NO4S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (E)-7-[(4S)-4-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbutyl]-2-oxo-1,3-thiazinan-3-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CN1C(=O)SCC[C@@H]1CC[C@@H](O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H27F2NO4S/c22-21(23,16-8-4-3-5-9-16)18(25)12-11-17-13-15-29-20(28)24(17)14-7-2-1-6-10-19(26)27/h2-5,7-9,17-18,25H,1,6,10-15H2,(H,26,27)/b7-2+/t17-,18+/m0/s1 |
| InChIKey | MXHGMNQKBINKSD-PYAHUTRISA-N |
| XLogP | 4.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|