C25H29F2NO4S2 — CID 67318344
propan-2-yl 5-[3-[(4R)-4-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate (PubChem CID 67318344) has the molecular formula C25H29F2NO4S2 and a molecular weight of 509.64 g/mol. Its IUPAC name is propan-2-yl 5-[3-[(4R)-4-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[(4R)-4-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67318344 |
| Molecular Formula | C25H29F2NO4S2 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | propan-2-yl 5-[3-[(4R)-4-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc(CCCN2C(=O)SCC[C@@H]2/C=C/[C@@H](O)C(F)(F)c2ccccc2)s1 |
| InChI | InChI=1S/C25H29F2NO4S2/c1-17(2)32-23(30)21-12-11-20(34-21)9-6-15-28-19(14-16-33-24(28)31)10-13-22(29)25(26,27)18-7-4-3-5-8-18/h3-5,7-8,10-13,17,19,22,29H,6,9,14-16H2,1-2H3/b13-10+/t19-,22+/m0/s1 |
| InChIKey | YDKRNOBSXBIZDR-BJSZDSINSA-N |
| XLogP | 5.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|