C22H23F2NO4S2 — CID 11282758
5-[3-[(4R)-4-[(E,3S)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 11282758) has the molecular formula C22H23F2NO4S2 and a molecular weight of 467.56 g/mol. Its IUPAC name is 5-[3-[(4R)-4-[(E,3S)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(4R)-4-[(E,3S)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 11282758 |
| Molecular Formula | C22H23F2NO4S2 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 5-[3-[(4R)-4-[(E,3S)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCN2C(=O)SCC[C@@H]2/C=C/[C@H](O)C(F)(F)c2ccccc2)s1 |
| InChI | InChI=1S/C22H23F2NO4S2/c23-22(24,15-5-2-1-3-6-15)19(26)11-8-16-12-14-30-21(29)25(16)13-4-7-17-9-10-18(31-17)20(27)28/h1-3,5-6,8-11,16,19,26H,4,7,12-14H2,(H,27,28)/b11-8+/t16-,19-/m0/s1 |
| InChIKey | KEKOPUZKMZEDTF-WGYRVSROSA-N |
| XLogP | 5.02 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|