C25H31NO4S2 — CID 72963236
propan-2-yl 5-[3-[4-(3-hydroxy-4-phenylbut-1-enyl)-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate (PubChem CID 72963236) has the molecular formula C25H31NO4S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is propan-2-yl 5-[3-[4-(3-hydroxy-4-phenylbut-1-enyl)-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate.
| Compound Name | propan-2-yl 5-[3-[4-(3-hydroxy-4-phenylbut-1-enyl)-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 72963236 |
| Molecular Formula | C25H31NO4S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | propan-2-yl 5-[3-[4-(3-hydroxy-4-phenylbut-1-enyl)-2-oxo-1,3-thiazinan-3-yl]propyl]thiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc(CCCN2C(=O)SCCC2C=CC(O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C25H31NO4S2/c1-18(2)30-24(28)23-13-12-22(32-23)9-6-15-26-20(14-16-31-25(26)29)10-11-21(27)17-19-7-4-3-5-8-19/h3-5,7-8,10-13,18,20-21,27H,6,9,14-17H2,1-2H3 |
| InChIKey | PRMSSCSZDFPHQL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|