C24H35NO4 — CID 86300956
(Z)-7-[(2S)-2-[(3R,4S)-3-hydroxy-4-methyl-6-phenylhexyl]-5-oxopyrrolidin-1-yl]hept-5-enoic acid (PubChem CID 86300956) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is (Z)-7-[(2S)-2-[(3R,4S)-3-hydroxy-4-methyl-6-phenylhexyl]-5-oxopyrrolidin-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S)-2-[(3R,4S)-3-hydroxy-4-methyl-6-phenylhexyl]-5-oxopyrrolidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 86300956 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (Z)-7-[(2S)-2-[(3R,4S)-3-hydroxy-4-methyl-6-phenylhexyl]-5-oxopyrrolidin-1-yl]hept-5-enoic acid |
| SMILES | C[C@@H](CCc1ccccc1)[C@H](O)CC[C@H]1CCC(=O)N1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C24H35NO4/c1-19(12-13-20-9-5-4-6-10-20)22(26)16-14-21-15-17-23(27)25(21)18-8-3-2-7-11-24(28)29/h3-6,8-10,19,21-22,26H,2,7,11-18H2,1H3,(H,28,29)/b8-3-/t19-,21-,22+/m0/s1 |
| InChIKey | GFHYPVRSDRKPAB-YNDMMJELSA-N |
| XLogP | 4.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|