C27H43NO4S — CID 118692114
methyl 4-[2-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate (PubChem CID 118692114) has the molecular formula C27H43NO4S and a molecular weight of 477.71 g/mol. Its IUPAC name is methyl 4-[2-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-[2-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 118692114 |
| Molecular Formula | C27H43NO4S |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | methyl 4-[2-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
| SMILES | COC(=O)CCCSCCN1C(=O)CCC1CC[C@@H](O)[C@@H](C)CCCCCc1ccccc1 |
| InChI | InChI=1S/C27H43NO4S/c1-22(10-5-3-6-11-23-12-7-4-8-13-23)25(29)17-15-24-16-18-26(30)28(24)19-21-33-20-9-14-27(31)32-2/h4,7-8,12-13,22,24-25,29H,3,5-6,9-11,14-21H2,1-2H3/t22-,24?,25+/m0/s1 |
| InChIKey | HBEYROGNLFNRRE-DEWJTGPOSA-N |
| XLogP | 5.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|