C29H39F2NO4S — CID 118160386
methyl 5-[3-[3,3-difluoro-5-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate (PubChem CID 118160386) has the molecular formula C29H39F2NO4S and a molecular weight of 535.70 g/mol. Its IUPAC name is methyl 5-[3-[3,3-difluoro-5-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[3,3-difluoro-5-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118160386 |
| Molecular Formula | C29H39F2NO4S |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | methyl 5-[3-[3,3-difluoro-5-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCCN2C(=O)C(F)(F)CC2CC[C@@H](O)[C@@H](C)CCCCCc2ccccc2)s1 |
| InChI | InChI=1S/C29H39F2NO4S/c1-21(10-5-3-6-11-22-12-7-4-8-13-22)25(33)17-15-23-20-29(30,31)28(35)32(23)19-9-14-24-16-18-26(37-24)27(34)36-2/h4,7-8,12-13,16,18,21,23,25,33H,3,5-6,9-11,14-15,17,19-20H2,1-2H3/t21-,23?,25+/m0/s1 |
| InChIKey | CUEAWPZVUZZWQF-KVCNQYIISA-N |
| XLogP | 6.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|