C26H33F2NO5S — CID 122598126
[5-[3-[(5S)-3,3-difluoro-5-[(3S)-3-hydroxy-7-phenylheptyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] methyl carbonate (PubChem CID 122598126) has the molecular formula C26H33F2NO5S and a molecular weight of 509.62 g/mol. Its IUPAC name is [5-[3-[(5S)-3,3-difluoro-5-[(3S)-3-hydroxy-7-phenylheptyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] methyl carbonate.
| Compound Name | [5-[3-[(5S)-3,3-difluoro-5-[(3S)-3-hydroxy-7-phenylheptyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 122598126 |
| Molecular Formula | C26H33F2NO5S |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [5-[3-[(5S)-3,3-difluoro-5-[(3S)-3-hydroxy-7-phenylheptyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(CCCN2C(=O)C(F)(F)C[C@@H]2CC[C@@H](O)CCCCc2ccccc2)s1 |
| InChI | InChI=1S/C26H33F2NO5S/c1-33-25(32)34-23-16-15-22(35-23)12-7-17-29-20(18-26(27,28)24(29)31)13-14-21(30)11-6-5-10-19-8-3-2-4-9-19/h2-4,8-9,15-16,20-21,30H,5-7,10-14,17-18H2,1H3/t20-,21-/m0/s1 |
| InChIKey | OXJXVENZTMUGCC-SFTDATJTSA-N |
| XLogP | 5.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|