C24H37NO5 — CID 11464268
7-[(2S)-2-[(3S)-3-hydroxy-4-[3-(2-methoxyethyl)phenyl]butyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 11464268) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is 7-[(2S)-2-[(3S)-3-hydroxy-4-[3-(2-methoxyethyl)phenyl]butyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2S)-2-[(3S)-3-hydroxy-4-[3-(2-methoxyethyl)phenyl]butyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 11464268 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 7-[(2S)-2-[(3S)-3-hydroxy-4-[3-(2-methoxyethyl)phenyl]butyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | COCCc1cccc(C[C@@H](O)CC[C@H]2CCC(=O)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C24H37NO5/c1-30-16-14-19-7-6-8-20(17-19)18-22(26)12-10-21-11-13-23(27)25(21)15-5-3-2-4-9-24(28)29/h6-8,17,21-22,26H,2-5,9-16,18H2,1H3,(H,28,29)/t21-,22-/m0/s1 |
| InChIKey | SHDNMDIQJRONIG-VXKWHMMOSA-N |
| XLogP | 3.59 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|