C18H26ClNO3 — CID 90870086
5-[(3R)-4-(3-chlorophenyl)-3-hydroxybutyl]-1-(4-hydroxybutyl)pyrrolidin-2-one (PubChem CID 90870086) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is 5-[(3R)-4-(3-chlorophenyl)-3-hydroxybutyl]-1-(4-hydroxybutyl)pyrrolidin-2-one.
| Compound Name | 5-[(3R)-4-(3-chlorophenyl)-3-hydroxybutyl]-1-(4-hydroxybutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 90870086 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-[(3R)-4-(3-chlorophenyl)-3-hydroxybutyl]-1-(4-hydroxybutyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(CC[C@@H](O)Cc2cccc(Cl)c2)N1CCCCO |
| InChI | InChI=1S/C18H26ClNO3/c19-15-5-3-4-14(12-15)13-17(22)8-6-16-7-9-18(23)20(16)10-1-2-11-21/h3-5,12,16-17,21-22H,1-2,6-11,13H2/t16?,17-/m1/s1 |
| InChIKey | SXAOQYWEOFJBKX-ZYMOGRSISA-N |
| XLogP | 2.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|