C22H31NO6S — CID 58770083
3-[4-[(2R)-1-[2-(3-carboxypropylsulfanyl)ethyl]-6-oxopiperidin-2-yl]-2-hydroxybutyl]benzoic acid (PubChem CID 58770083) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is 3-[4-[(2R)-1-[2-(3-carboxypropylsulfanyl)ethyl]-6-oxopiperidin-2-yl]-2-hydroxybutyl]benzoic acid.
| Compound Name | 3-[4-[(2R)-1-[2-(3-carboxypropylsulfanyl)ethyl]-6-oxopiperidin-2-yl]-2-hydroxybutyl]benzoic acid |
|---|---|
| PubChem CID | 58770083 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-[4-[(2R)-1-[2-(3-carboxypropylsulfanyl)ethyl]-6-oxopiperidin-2-yl]-2-hydroxybutyl]benzoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CCC[C@@H]1CCC(O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H31NO6S/c24-19(15-16-4-1-5-17(14-16)22(28)29)10-9-18-6-2-7-20(25)23(18)11-13-30-12-3-8-21(26)27/h1,4-5,14,18-19,24H,2-3,6-13,15H2,(H,26,27)(H,28,29)/t18-,19?/m1/s1 |
| InChIKey | KNICYICAYAVRCZ-MRTLOADZSA-N |
| XLogP | 3.05 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|