C20H31NO4S — CID 58804827
7-[(2R)-2-(3-hydroxy-4-thiophen-2-ylbutyl)-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 58804827) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 7-[(2R)-2-(3-hydroxy-4-thiophen-2-ylbutyl)-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-(3-hydroxy-4-thiophen-2-ylbutyl)-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 58804827 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 7-[(2R)-2-(3-hydroxy-4-thiophen-2-ylbutyl)-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC[C@@H]1CCC(O)Cc1cccs1 |
| InChI | InChI=1S/C20H31NO4S/c22-17(15-18-8-6-14-26-18)12-11-16-7-5-9-19(23)21(16)13-4-2-1-3-10-20(24)25/h6,8,14,16-17,22H,1-5,7,9-13,15H2,(H,24,25)/t16-,17?/m1/s1 |
| InChIKey | YJOQFGHSXWGTNB-TZHYSIJRSA-N |
| XLogP | 3.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|