C22H33N5O2 — CID 11395460
(6R)-6-[(3S)-3-hydroxy-4-phenylbutyl]-1-[6-(5H-tetrazol-5-yl)hexyl]piperidin-2-one (PubChem CID 11395460) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is (6R)-6-[(3S)-3-hydroxy-4-phenylbutyl]-1-[6-(5H-tetrazol-5-yl)hexyl]piperidin-2-one.
| Compound Name | (6R)-6-[(3S)-3-hydroxy-4-phenylbutyl]-1-[6-(5H-tetrazol-5-yl)hexyl]piperidin-2-one |
|---|---|
| PubChem CID | 11395460 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (6R)-6-[(3S)-3-hydroxy-4-phenylbutyl]-1-[6-(5H-tetrazol-5-yl)hexyl]piperidin-2-one |
| SMILES | O=C1CCC[C@H](CC[C@H](O)Cc2ccccc2)N1CCCCCCC1N=NN=N1 |
| InChI | InChI=1S/C22H33N5O2/c28-20(17-18-9-4-3-5-10-18)15-14-19-11-8-13-22(29)27(19)16-7-2-1-6-12-21-23-25-26-24-21/h3-5,9-10,19-21,28H,1-2,6-8,11-17H2/t19-,20+/m1/s1 |
| InChIKey | IIZQZSWSGBWSMQ-UXHICEINSA-N |
| XLogP | 4.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|