C21H34N2O3 — CID 69021166
1-[4-(2-aminoethoxy)butyl]-6-(3-hydroxy-4-phenylbutyl)piperidin-2-one (PubChem CID 69021166) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-[4-(2-aminoethoxy)butyl]-6-(3-hydroxy-4-phenylbutyl)piperidin-2-one.
| Compound Name | 1-[4-(2-aminoethoxy)butyl]-6-(3-hydroxy-4-phenylbutyl)piperidin-2-one |
|---|---|
| PubChem CID | 69021166 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-[4-(2-aminoethoxy)butyl]-6-(3-hydroxy-4-phenylbutyl)piperidin-2-one |
| SMILES | NCCOCCCCN1C(=O)CCCC1CCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H34N2O3/c22-13-16-26-15-5-4-14-23-19(9-6-10-21(23)25)11-12-20(24)17-18-7-2-1-3-8-18/h1-3,7-8,19-20,24H,4-6,9-17,22H2 |
| InChIKey | IYQHAXJKBZVACD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|