C19H35NO4S — CID 58770096
4-[2-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 58770096) has the molecular formula C19H35NO4S and a molecular weight of 373.56 g/mol. Its IUPAC name is 4-[2-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 58770096 |
| Molecular Formula | C19H35NO4S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 4-[2-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | CCCCCC(O)CC[C@H]1CCCC(=O)N1CCSCCCC(=O)O |
| InChI | InChI=1S/C19H35NO4S/c1-2-3-4-8-17(21)12-11-16-7-5-9-18(22)20(16)13-15-25-14-6-10-19(23)24/h16-17,21H,2-15H2,1H3,(H,23,24)/t16-,17?/m1/s1 |
| InChIKey | QKBNFESAEHSMIX-TZHYSIJRSA-N |
| XLogP | 3.69 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|