C22H42N2O3 — CID 58804748
N-ethyl-7-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]heptanamide (PubChem CID 58804748) has the molecular formula C22H42N2O3 and a molecular weight of 382.59 g/mol. Its IUPAC name is N-ethyl-7-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]heptanamide.
| Compound Name | N-ethyl-7-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]heptanamide |
|---|---|
| PubChem CID | 58804748 |
| Molecular Formula | C22H42N2O3 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | N-ethyl-7-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]heptanamide |
| SMILES | CCCCCC(O)CC[C@H]1CCCC(=O)N1CCCCCCC(=O)NCC |
| InChI | InChI=1S/C22H42N2O3/c1-3-5-8-13-20(25)17-16-19-12-11-15-22(27)24(19)18-10-7-6-9-14-21(26)23-4-2/h19-20,25H,3-18H2,1-2H3,(H,23,26)/t19-,20?/m1/s1 |
| InChIKey | GIEBTFAGQXBZFU-FIWHBWSRSA-N |
| XLogP | 4.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|