C21H37NO4 — CID 10316917
methyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]heptanoate (PubChem CID 10316917) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is methyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]heptanoate.
| Compound Name | methyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 10316917 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | methyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CCCCCC(O)/C=C/C1CCCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H37NO4/c1-3-4-7-12-19(23)16-15-18-11-10-13-20(24)22(18)17-9-6-5-8-14-21(25)26-2/h15-16,18-19,23H,3-14,17H2,1-2H3/b16-15+ |
| InChIKey | SSCWSORHCBPVOS-FOCLMDBBSA-N |
| XLogP | 3.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|