C20H35NO4 — CID 22770548
7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-2-methylheptanoic acid (PubChem CID 22770548) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-2-methylheptanoic acid.
| Compound Name | 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 22770548 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-2-methylheptanoic acid |
| SMILES | CCCCCC(O)/C=C/C1CCC(=O)N1CCCCCC(C)C(=O)O |
| InChI | InChI=1S/C20H35NO4/c1-3-4-6-10-18(22)13-11-17-12-14-19(23)21(17)15-8-5-7-9-16(2)20(24)25/h11,13,16-18,22H,3-10,12,14-15H2,1-2H3,(H,24,25)/b13-11+ |
| InChIKey | QJKUSUZYVRPXOB-ACCUITESSA-N |
| XLogP | 3.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|