C19H33NO4S — CID 10109784
4-[2-[(2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-3-methylbutanoic acid (PubChem CID 10109784) has the molecular formula C19H33NO4S and a molecular weight of 371.54 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-3-methylbutanoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10109784 |
| Molecular Formula | C19H33NO4S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-3-methylbutanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)N1CCSCC(C)CC(=O)O |
| InChI | InChI=1S/C19H33NO4S/c1-3-4-5-6-17(21)9-7-16-8-10-18(22)20(16)11-12-25-14-15(2)13-19(23)24/h7,9,15-17,21H,3-6,8,10-14H2,1-2H3,(H,23,24)/b9-7+/t15?,16-,17-/m0/s1 |
| InChIKey | VFDPQHHUHQFUSJ-YYJDLYEMSA-N |
| XLogP | 3.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|