C27H47NO6S — CID 67411919
2-[4-[2-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoyloxy]ethyl 2-ethyl-2-methylbutanoate (PubChem CID 67411919) has the molecular formula C27H47NO6S and a molecular weight of 513.74 g/mol. Its IUPAC name is 2-[4-[2-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoyloxy]ethyl 2-ethyl-2-methylbutanoate.
| Compound Name | 2-[4-[2-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoyloxy]ethyl 2-ethyl-2-methylbutanoate |
|---|---|
| PubChem CID | 67411919 |
| Molecular Formula | C27H47NO6S |
| Molecular Weight | 513.74 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 2-[4-[2-[(2R)-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoyloxy]ethyl 2-ethyl-2-methylbutanoate |
| SMILES | CCCCC[C@@H](O)/C=C/[C@H]1CCC(=O)N1CCSCCCC(=O)OCCOC(=O)C(C)(CC)CC |
| InChI | InChI=1S/C27H47NO6S/c1-5-8-9-11-23(29)15-13-22-14-16-24(30)28(22)17-21-35-20-10-12-25(31)33-18-19-34-26(32)27(4,6-2)7-3/h13,15,22-23,29H,5-12,14,16-21H2,1-4H3/b15-13+/t22-,23+/m0/s1 |
| InChIKey | XTYXUKTYVKNGIN-OAJATRTFSA-N |
| XLogP | 4.90 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|