C26H39NO4S — CID 56834118
butyl 4-[2-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate (PubChem CID 56834118) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is butyl 4-[2-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate.
| Compound Name | butyl 4-[2-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 56834118 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | butyl 4-[2-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
| SMILES | CCCCOC(=O)CCCSCCN1C(=O)CC[C@@H]1/C=C/[C@@H](O)Cc1cccc(CC)c1 |
| InChI | InChI=1S/C26H39NO4S/c1-3-5-16-31-26(30)10-7-17-32-18-15-27-23(12-14-25(27)29)11-13-24(28)20-22-9-6-8-21(4-2)19-22/h6,8-9,11,13,19,23-24,28H,3-5,7,10,12,14-18,20H2,1-2H3/b13-11+/t23-,24+/m0/s1 |
| InChIKey | UZXBAGDTBBIJFY-KVKMCETFSA-N |
| XLogP | 4.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|