C21H31NO3S — CID 91423369
(5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]pyrrolidin-2-one (PubChem CID 91423369) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91423369 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (5R)-1-[2-(4-hydroxybutylsulfanyl)ethyl]-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C[C@H](O)C=C[C@H]2CCC(=O)N2CCSCCCCO)c1 |
| InChI | InChI=1S/C21H31NO3S/c1-17-5-4-6-18(15-17)16-20(24)9-7-19-8-10-21(25)22(19)11-14-26-13-3-2-12-23/h4-7,9,15,19-20,23-24H,2-3,8,10-14,16H2,1H3/t19-,20+/m0/s1 |
| InChIKey | VQMPTDNIMHTGEW-VQTJNVASSA-N |
| XLogP | 2.95 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|