C21H26N2O3S2 — CID 91205705
(5R)-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1-[2-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]sulfanyl]ethyl]pyrrolidin-2-one (PubChem CID 91205705) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (5R)-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1-[2-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]sulfanyl]ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1-[2-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]sulfanyl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91205705 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (5R)-5-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1-[2-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]sulfanyl]ethyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C[C@H](O)C=C[C@H]2CCC(=O)N2CCSc2ncc(CO)s2)c1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-15-3-2-4-16(11-15)12-18(25)7-5-17-6-8-20(26)23(17)9-10-27-21-22-13-19(14-24)28-21/h2-5,7,11,13,17-18,24-25H,6,8-10,12,14H2,1H3/t17-,18+/m0/s1 |
| InChIKey | DKSQBFCQUKJQDD-ZWKOTPCHSA-N |
| XLogP | 3.19 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|