C21H30ClNO3S — CID 90949425
(5R)-5-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-methoxybutylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 90949425) has the molecular formula C21H30ClNO3S and a molecular weight of 412.00 g/mol. Its IUPAC name is (5R)-5-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-methoxybutylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-methoxybutylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90949425 |
| Molecular Formula | C21H30ClNO3S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (5R)-5-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-1-[2-(4-methoxybutylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | COCCCCSCCN1C(=O)CC[C@@H]1C=C[C@@H](O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H30ClNO3S/c1-26-12-2-3-13-27-14-11-23-19(8-10-21(23)25)7-9-20(24)16-17-5-4-6-18(22)15-17/h4-7,9,15,19-20,24H,2-3,8,10-14,16H2,1H3/t19-,20+/m0/s1 |
| InChIKey | MPGZMEGDSQJFEG-VQTJNVASSA-N |
| XLogP | 3.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|