C21H26F3NO4S — CID 69340802
4-[2-[(2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 69340802) has the molecular formula C21H26F3NO4S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 69340802 |
| Molecular Formula | C21H26F3NO4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[2-[(2R)-2-[3-hydroxy-4-[3-(trifluoromethyl)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSCCN1C(=O)CC[C@@H]1C=CC(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H26F3NO4S/c22-21(23,24)16-4-1-3-15(13-16)14-18(26)8-6-17-7-9-19(27)25(17)10-12-30-11-2-5-20(28)29/h1,3-4,6,8,13,17-18,26H,2,5,7,9-12,14H2,(H,28,29)/t17-,18?/m0/s1 |
| InChIKey | MFYFIBPZCXBESI-ZENAZSQFSA-N |
| XLogP | 3.75 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|