C25H26N2O4 — CID 90883740
3-[[(2R)-2-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]methyl]-1H-indole-6-carboxylic acid (PubChem CID 90883740) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-[[(2R)-2-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]methyl]-1H-indole-6-carboxylic acid.
| Compound Name | 3-[[(2R)-2-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]methyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 90883740 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[[(2R)-2-[(3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-oxopyrrolidin-1-yl]methyl]-1H-indole-6-carboxylic acid |
| SMILES | Cc1cccc(C[C@H](O)C=C[C@H]2CCC(=O)N2Cc2c[nH]c3cc(C(=O)O)ccc23)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-16-3-2-4-17(11-16)12-21(28)8-6-20-7-10-24(29)27(20)15-19-14-26-23-13-18(25(30)31)5-9-22(19)23/h2-6,8-9,11,13-14,20-21,26,28H,7,10,12,15H2,1H3,(H,30,31)/t20-,21+/m0/s1 |
| InChIKey | KPQOMOOVALVQAX-LEWJYISDSA-N |
| XLogP | 3.83 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|