C22H39NO4 — CID 22770546
ethyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-5-methylheptanoate (PubChem CID 22770546) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is ethyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-5-methylheptanoate.
| Compound Name | ethyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-5-methylheptanoate |
|---|---|
| PubChem CID | 22770546 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | ethyl 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-5-methylheptanoate |
| SMILES | CCCCCC(O)/C=C/C1CCC(=O)N1CCC(C)CCCC(=O)OCC |
| InChI | InChI=1S/C22H39NO4/c1-4-6-7-10-20(24)14-12-19-13-15-21(25)23(19)17-16-18(3)9-8-11-22(26)27-5-2/h12,14,18-20,24H,4-11,13,15-17H2,1-3H3/b14-12+ |
| InChIKey | UZZHEQIXVMPPCO-WYMLVPIESA-N |
| XLogP | 4.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|