C20H30N2O4S2 — CID 91353125
ethyl 2-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate (PubChem CID 91353125) has the molecular formula C20H30N2O4S2 and a molecular weight of 426.60 g/mol. Its IUPAC name is ethyl 2-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 91353125 |
| Molecular Formula | C20H30N2O4S2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethyl 2-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCC[C@H](O)C=C[C@H]1CCC(=O)N1CCSc1nc(C(=O)OCC)cs1 |
| InChI | InChI=1S/C20H30N2O4S2/c1-3-5-6-7-16(23)10-8-15-9-11-18(24)22(15)12-13-27-20-21-17(14-28-20)19(25)26-4-2/h8,10,14-16,23H,3-7,9,11-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | GNHGUCHEYAOCCJ-HOTGVXAUSA-N |
| XLogP | 3.90 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|