C21H32N2O3S2 — CID 142802474
ethyl 2-[2-[2-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazol-4-yl]acetate (PubChem CID 142802474) has the molecular formula C21H32N2O3S2 and a molecular weight of 424.63 g/mol. Its IUPAC name is ethyl 2-[2-[2-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 142802474 |
| Molecular Formula | C21H32N2O3S2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | ethyl 2-[2-[2-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCCCC/C=C/C1CCC(=O)N1CCSc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C21H32N2O3S2/c1-3-5-6-7-8-9-10-18-11-12-19(24)23(18)13-14-27-21-22-17(16-28-21)15-20(25)26-4-2/h9-10,16,18H,3-8,11-15H2,1-2H3/b10-9+ |
| InChIKey | HXZZTBUPVUHQDE-MDZDMXLPSA-N |
| XLogP | 4.86 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|