C23H31N3O4S2 — CID 77287746
2-[2-[2-[(4-hexoxyanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 77287746) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[2-[2-[(4-hexoxyanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-[(4-hexoxyanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 77287746 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-[2-[2-[(4-hexoxyanilino)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCCOc1ccc(NCC2CCC(=O)N2CCSc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C23H31N3O4S2/c1-2-3-4-5-13-30-19-9-6-17(7-10-19)24-15-18-8-11-21(27)26(18)12-14-31-23-25-20(16-32-23)22(28)29/h6-7,9-10,16,18,24H,2-5,8,11-15H2,1H3,(H,28,29) |
| InChIKey | OGJWCOZFARJXOI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|