C17H15F4N3O3S2 — CID 91434583
2-[2-[2-oxo-5-[(2,3,4,5-tetrafluoroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 91434583) has the molecular formula C17H15F4N3O3S2 and a molecular weight of 449.45 g/mol. Its IUPAC name is 2-[2-[2-oxo-5-[(2,3,4,5-tetrafluoroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-oxo-5-[(2,3,4,5-tetrafluoroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91434583 |
| Molecular Formula | C17H15F4N3O3S2 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-[2-[2-oxo-5-[(2,3,4,5-tetrafluoroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(SCCN2C(=O)CCC2CNc2cc(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C17H15F4N3O3S2/c18-9-5-10(14(20)15(21)13(9)19)22-6-8-1-2-12(25)24(8)3-4-28-17-23-11(7-29-17)16(26)27/h5,7-8,22H,1-4,6H2,(H,26,27) |
| InChIKey | YSJGXVJDPONLCX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|