C21H29F2NO — CID 142208351
5-[(E)-4-(3,5-difluorophenyl)but-1-enyl]-1-heptylpyrrolidin-2-one (PubChem CID 142208351) has the molecular formula C21H29F2NO and a molecular weight of 349.47 g/mol. Its IUPAC name is 5-[(E)-4-(3,5-difluorophenyl)but-1-enyl]-1-heptylpyrrolidin-2-one.
| Compound Name | 5-[(E)-4-(3,5-difluorophenyl)but-1-enyl]-1-heptylpyrrolidin-2-one |
|---|---|
| PubChem CID | 142208351 |
| Molecular Formula | C21H29F2NO |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 5-[(E)-4-(3,5-difluorophenyl)but-1-enyl]-1-heptylpyrrolidin-2-one |
| SMILES | CCCCCCCN1C(=O)CCC1/C=C/CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H29F2NO/c1-2-3-4-5-8-13-24-20(11-12-21(24)25)10-7-6-9-17-14-18(22)16-19(23)15-17/h7,10,14-16,20H,2-6,8-9,11-13H2,1H3/b10-7+ |
| InChIKey | UCSVFDWOQWLXIG-JXMROGBWSA-N |
| XLogP | 5.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|