C24H30FNS — CID 142208596
1-[(5-butylthiophen-2-yl)methyl]-2-[(E)-4-(4-fluorophenyl)but-1-enyl]-5-methylidenepyrrolidine (PubChem CID 142208596) has the molecular formula C24H30FNS and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-[(5-butylthiophen-2-yl)methyl]-2-[(E)-4-(4-fluorophenyl)but-1-enyl]-5-methylidenepyrrolidine.
| Compound Name | 1-[(5-butylthiophen-2-yl)methyl]-2-[(E)-4-(4-fluorophenyl)but-1-enyl]-5-methylidenepyrrolidine |
|---|---|
| PubChem CID | 142208596 |
| Molecular Formula | C24H30FNS |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[(5-butylthiophen-2-yl)methyl]-2-[(E)-4-(4-fluorophenyl)but-1-enyl]-5-methylidenepyrrolidine |
| SMILES | C=C1CCC(/C=C/CCc2ccc(F)cc2)N1Cc1ccc(CCCC)s1 |
| InChI | InChI=1S/C24H30FNS/c1-3-4-9-23-16-17-24(27-23)18-26-19(2)10-15-22(26)8-6-5-7-20-11-13-21(25)14-12-20/h6,8,11-14,16-17,22H,2-5,7,9-10,15,18H2,1H3/b8-6+ |
| InChIKey | AIFSGVCZXFQKSQ-SOFGYWHQSA-N |
| XLogP | 6.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|