C23H35NOS — CID 142208434
1-heptyl-5-[(E)-4-[3-(methoxymethyl)phenyl]but-1-enyl]pyrrolidine-2-thione (PubChem CID 142208434) has the molecular formula C23H35NOS and a molecular weight of 373.61 g/mol. Its IUPAC name is 1-heptyl-5-[(E)-4-[3-(methoxymethyl)phenyl]but-1-enyl]pyrrolidine-2-thione.
| Compound Name | 1-heptyl-5-[(E)-4-[3-(methoxymethyl)phenyl]but-1-enyl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 142208434 |
| Molecular Formula | C23H35NOS |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-heptyl-5-[(E)-4-[3-(methoxymethyl)phenyl]but-1-enyl]pyrrolidine-2-thione |
| SMILES | CCCCCCCN1C(=S)CCC1/C=C/CCc1cccc(COC)c1 |
| InChI | InChI=1S/C23H35NOS/c1-3-4-5-6-9-17-24-22(15-16-23(24)26)14-8-7-11-20-12-10-13-21(18-20)19-25-2/h8,10,12-14,18,22H,3-7,9,11,15-17,19H2,1-2H3/b14-8+ |
| InChIKey | UGWZMZXCLASESA-RIYZIHGNSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|