C21H30ClNOS — CID 142208539
5-[(E)-4-(3-chlorophenyl)but-1-enyl]-1-[2-(2-methylbutylsulfanyl)ethyl]pyrrolidin-2-one (PubChem CID 142208539) has the molecular formula C21H30ClNOS and a molecular weight of 380.00 g/mol. Its IUPAC name is 5-[(E)-4-(3-chlorophenyl)but-1-enyl]-1-[2-(2-methylbutylsulfanyl)ethyl]pyrrolidin-2-one.
| Compound Name | 5-[(E)-4-(3-chlorophenyl)but-1-enyl]-1-[2-(2-methylbutylsulfanyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142208539 |
| Molecular Formula | C21H30ClNOS |
| Molecular Weight | 380.00 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 5-[(E)-4-(3-chlorophenyl)but-1-enyl]-1-[2-(2-methylbutylsulfanyl)ethyl]pyrrolidin-2-one |
| SMILES | CCC(C)CSCCN1C(=O)CCC1/C=C/CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H30ClNOS/c1-3-17(2)16-25-14-13-23-20(11-12-21(23)24)10-5-4-7-18-8-6-9-19(22)15-18/h5-6,8-10,15,17,20H,3-4,7,11-14,16H2,1-2H3/b10-5+ |
| InChIKey | MJWGCZDLFWWYAR-BJMVGYQFSA-N |
| XLogP | 5.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|