C20H24ClNO5 — CID 22720067
2-[4-[2-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid (PubChem CID 22720067) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-[4-[2-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid.
| Compound Name | 2-[4-[2-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
|---|---|
| PubChem CID | 22720067 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[4-[2-[(E)-4-(3-chlorophenyl)-3-oxobut-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
| SMILES | O=C(O)COCCCCN1C(=O)CCC1/C=C/C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H24ClNO5/c21-16-5-3-4-15(12-16)13-18(23)8-6-17-7-9-19(24)22(17)10-1-2-11-27-14-20(25)26/h3-6,8,12,17H,1-2,7,9-11,13-14H2,(H,25,26)/b8-6+ |
| InChIKey | PZFPKOXKWFXYAW-SOFGYWHQSA-N |
| XLogP | 2.88 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|