C14H20F3NOS — CID 56871312
4-[(5-butylthiophen-2-yl)methyl]-2-(trifluoromethyl)morpholine (PubChem CID 56871312) has the molecular formula C14H20F3NOS and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-[(5-butylthiophen-2-yl)methyl]-2-(trifluoromethyl)morpholine.
| Compound Name | 4-[(5-butylthiophen-2-yl)methyl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 56871312 |
| Molecular Formula | C14H20F3NOS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[(5-butylthiophen-2-yl)methyl]-2-(trifluoromethyl)morpholine |
| SMILES | CCCCc1ccc(CN2CCOC(C(F)(F)F)C2)s1 |
| InChI | InChI=1S/C14H20F3NOS/c1-2-3-4-11-5-6-12(20-11)9-18-7-8-19-13(10-18)14(15,16)17/h5-6,13H,2-4,7-10H2,1H3 |
| InChIKey | WDCFJNWTHWLFAA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |