C12H15F3N2O3 — CID 56862557
5-methoxy-2-[[2-(trifluoromethyl)morpholin-4-yl]methyl]-1H-pyridin-4-one (PubChem CID 56862557) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 5-methoxy-2-[[2-(trifluoromethyl)morpholin-4-yl]methyl]-1H-pyridin-4-one.
| Compound Name | 5-methoxy-2-[[2-(trifluoromethyl)morpholin-4-yl]methyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 56862557 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-methoxy-2-[[2-(trifluoromethyl)morpholin-4-yl]methyl]-1H-pyridin-4-one |
| SMILES | COc1c[nH]c(CN2CCOC(C(F)(F)F)C2)cc1=O |
| InChI | InChI=1S/C12H15F3N2O3/c1-19-10-5-16-8(4-9(10)18)6-17-2-3-20-11(7-17)12(13,14)15/h4-5,11H,2-3,6-7H2,1H3,(H,16,18) |
| InChIKey | HRIZMLGTGVUULJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |