C17H24F3NO3 — CID 56874321
4-[(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)morpholine (PubChem CID 56874321) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-[(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)morpholine.
| Compound Name | 4-[(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 56874321 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-[(3-ethoxy-4-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)morpholine |
| SMILES | CCOc1cc(CN2CCOC(C(F)(F)F)C2)ccc1OC(C)C |
| InChI | InChI=1S/C17H24F3NO3/c1-4-22-15-9-13(5-6-14(15)24-12(2)3)10-21-7-8-23-16(11-21)17(18,19)20/h5-6,9,12,16H,4,7-8,10-11H2,1-3H3 |
| InChIKey | NIJIXEVVHVVMAZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |