C13H19ClF3N3O — CID 95502324
(2R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)morpholine (PubChem CID 95502324) has the molecular formula C13H19ClF3N3O and a molecular weight of 325.76 g/mol. Its IUPAC name is (2R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)morpholine.
| Compound Name | (2R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 95502324 |
| Molecular Formula | C13H19ClF3N3O |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2R)-4-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)morpholine |
| SMILES | CCCCc1nc(Cl)c(CN2CCO[C@@H](C(F)(F)F)C2)[nH]1 |
| InChI | InChI=1S/C13H19ClF3N3O/c1-2-3-4-11-18-9(12(14)19-11)7-20-5-6-21-10(8-20)13(15,16)17/h10H,2-8H2,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | AKQJSNCRCWXFEH-SNVBAGLBSA-N |
| XLogP | 3.17 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |