C18H25ClN4 — CID 10404561
1-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-phenylpiperazine (PubChem CID 10404561) has the molecular formula C18H25ClN4 and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-phenylpiperazine.
| Compound Name | 1-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 10404561 |
| Molecular Formula | C18H25ClN4 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-phenylpiperazine |
| SMILES | CCCCc1nc(Cl)c(CN2CCN(c3ccccc3)CC2)[nH]1 |
| InChI | InChI=1S/C18H25ClN4/c1-2-3-9-17-20-16(18(19)21-17)14-22-10-12-23(13-11-22)15-7-5-4-6-8-15/h4-8H,2-3,9-14H2,1H3,(H,20,21) |
| InChIKey | XZUPMRNJTFUINR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |