C19H26N4O2 — CID 122561842
4-[4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]benzoic acid (PubChem CID 122561842) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 122561842 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-[4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazin-1-yl]benzoic acid |
| SMILES | CCCCc1ncc(CN2CCN(c3ccc(C(=O)O)cc3)CC2)[nH]1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-3-4-18-20-13-16(21-18)14-22-9-11-23(12-10-22)17-7-5-15(6-8-17)19(24)25/h5-8,13H,2-4,9-12,14H2,1H3,(H,20,21)(H,24,25) |
| InChIKey | SABIAGANBCOFPU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |