C21H30ClN3O — CID 56705169
[1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-[(4-chlorophenyl)methyl]piperidin-4-yl]methanol (PubChem CID 56705169) has the molecular formula C21H30ClN3O and a molecular weight of 375.94 g/mol. Its IUPAC name is [1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-[(4-chlorophenyl)methyl]piperidin-4-yl]methanol.
| Compound Name | [1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-[(4-chlorophenyl)methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 56705169 |
| Molecular Formula | C21H30ClN3O |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | [1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-[(4-chlorophenyl)methyl]piperidin-4-yl]methanol |
| SMILES | CCCCc1ncc(CN2CCC(CO)(Cc3ccc(Cl)cc3)CC2)[nH]1 |
| InChI | InChI=1S/C21H30ClN3O/c1-2-3-4-20-23-14-19(24-20)15-25-11-9-21(16-26,10-12-25)13-17-5-7-18(22)8-6-17/h5-8,14,26H,2-4,9-13,15-16H2,1H3,(H,23,24) |
| InChIKey | LMRLFDCMDDPSKD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |