C22H34N4O — CID 45205775
2-[4-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(2-phenylethyl)piperazin-2-yl]ethanol (PubChem CID 45205775) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-[4-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(2-phenylethyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(2-phenylethyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45205775 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 2-[4-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(2-phenylethyl)piperazin-2-yl]ethanol |
| SMILES | CCCCc1ncc(CN2CCN(CCc3ccccc3)C(CCO)C2)[nH]1 |
| InChI | InChI=1S/C22H34N4O/c1-2-3-9-22-23-16-20(24-22)17-25-13-14-26(21(18-25)11-15-27)12-10-19-7-5-4-6-8-19/h4-8,16,21,27H,2-3,9-15,17-18H2,1H3,(H,23,24) |
| InChIKey | KYVUELLBDCAXGB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |