C23H29N5O — CID 92764853
2-[(2R)-1-(2-phenylethyl)-4-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 92764853) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[(2R)-1-(2-phenylethyl)-4-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-(2-phenylethyl)-4-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 92764853 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[(2R)-1-(2-phenylethyl)-4-[(1-pyrimidin-2-ylpyrrol-2-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CN(Cc2cccn2-c2ncccn2)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C23H29N5O/c29-17-10-21-18-26(15-16-27(21)14-9-20-6-2-1-3-7-20)19-22-8-4-13-28(22)23-24-11-5-12-25-23/h1-8,11-13,21,29H,9-10,14-19H2/t21-/m1/s1 |
| InChIKey | JKVZOAYYSSAHOQ-OAQYLSRUSA-N |
| XLogP | 2.38 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |