C20H34N2O — CID 29208638
2-[(2S)-1-(3-methylbutyl)-4-(3-phenylpropyl)piperazin-2-yl]ethanol (PubChem CID 29208638) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is 2-[(2S)-1-(3-methylbutyl)-4-(3-phenylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-(3-methylbutyl)-4-(3-phenylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 29208638 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 2-[(2S)-1-(3-methylbutyl)-4-(3-phenylpropyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)CCN1CCN(CCCc2ccccc2)C[C@@H]1CCO |
| InChI | InChI=1S/C20H34N2O/c1-18(2)10-13-22-15-14-21(17-20(22)11-16-23)12-6-9-19-7-4-3-5-8-19/h3-5,7-8,18,20,23H,6,9-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | SMXRFBSCDJHLAW-FQEVSTJZSA-N |
| XLogP | 3.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |