C26H34N4O — CID 45172721
2-[4-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol (PubChem CID 45172721) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[4-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45172721 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[4-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
| SMILES | Cn1cc(CN2CCN(CCCc3ccccc3)C(CCO)C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H34N4O/c1-28-19-24(26(27-28)23-12-6-3-7-13-23)20-29-16-17-30(25(21-29)14-18-31)15-8-11-22-9-4-2-5-10-22/h2-7,9-10,12-13,19,25,31H,8,11,14-18,20-21H2,1H3 |
| InChIKey | UQECSUXYMZJBMK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |