C24H30N2O — CID 23723883
2-[4-[(4-ethynylphenyl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol (PubChem CID 23723883) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[4-[(4-ethynylphenyl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(4-ethynylphenyl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 23723883 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[4-[(4-ethynylphenyl)methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
| SMILES | C#Cc1ccc(CN2CCN(CCCc3ccccc3)C(CCO)C2)cc1 |
| InChI | InChI=1S/C24H30N2O/c1-2-21-10-12-23(13-11-21)19-25-16-17-26(24(20-25)14-18-27)15-6-9-22-7-4-3-5-8-22/h1,3-5,7-8,10-13,24,27H,6,9,14-20H2 |
| InChIKey | FTCJENMAFZKBFE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|