C22H33N3O — CID 25274405
[(3R)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol (PubChem CID 25274405) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is [(3R)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 25274405 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | [(3R)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
| SMILES | CCCCc1ncc(CN2CCC[C@](CO)(CCc3ccccc3)C2)[nH]1 |
| InChI | InChI=1S/C22H33N3O/c1-2-3-10-21-23-15-20(24-21)16-25-14-7-12-22(17-25,18-26)13-11-19-8-5-4-6-9-19/h4-6,8-9,15,26H,2-3,7,10-14,16-18H2,1H3,(H,23,24)/t22-/m0/s1 |
| InChIKey | TYZPMIFSLCJSDS-QFIPXVFZSA-N |
| XLogP | 3.96 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |