C23H29N3O — CID 42197449
[(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol (PubChem CID 42197449) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 42197449 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [(3S)-1-[(1-methylbenzimidazol-2-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
| SMILES | Cn1c(CN2CCC[C@@](CO)(CCc3ccccc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C23H29N3O/c1-25-21-11-6-5-10-20(21)24-22(25)16-26-15-7-13-23(17-26,18-27)14-12-19-8-3-2-4-9-19/h2-6,8-11,27H,7,12-18H2,1H3/t23-/m1/s1 |
| InChIKey | BNSAWVKLXIFSOZ-HSZRJFAPSA-N |
| XLogP | 3.78 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |